C16H18N2O3 — CID 103999848
2-[propyl(prop-2-ynyl)carbamoyl]-1,3-dihydroisoindole-5-carboxylic acid (PubChem CID 103999848) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-[propyl(prop-2-ynyl)carbamoyl]-1,3-dihydroisoindole-5-carboxylic acid.
| Compound Name | 2-[propyl(prop-2-ynyl)carbamoyl]-1,3-dihydroisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 103999848 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-[propyl(prop-2-ynyl)carbamoyl]-1,3-dihydroisoindole-5-carboxylic acid |
| SMILES | C#CCN(CCC)C(=O)N1Cc2ccc(C(=O)O)cc2C1 |
| InChI | InChI=1S/C16H18N2O3/c1-3-7-17(8-4-2)16(21)18-10-13-6-5-12(15(19)20)9-14(13)11-18/h1,5-6,9H,4,7-8,10-11H2,2H3,(H,19,20) |
| InChIKey | NJRYWWZJFYRBLN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|