About 2-(4-methylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole
2-(4-methylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole (PubChem CID 1040002) has the molecular formula C16H13N3
and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-(4-methylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole |
| PubChem CID | 1040002 |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 2-(4-methylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole |
| SMILES | Cc1ccc(-c2nc3n(n2)Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C16H13N3/c1-11-6-8-12(9-7-11)15-17-16-14-5-3-2-4-13(14)10-19(16)18-15/h2-9H,10H2,1H3 |
| InChIKey | QBPTUGPJJOOHAY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole?
The IUPAC name of 2-(4-methylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole (CID 1040002) is 2-(4-methylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole.
What is the SMILES notation for 2-(4-methylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole?
The canonical SMILES for 2-(4-methylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole is Cc1ccc(-c2nc3n(n2)Cc2ccccc2-3)cc1.
What is the InChIKey of 2-(4-methylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole?
The InChIKey is QBPTUGPJJOOHAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3/c1-11-6-8-12(9-7-11)15-17-16-14-5-3-2-4-13(14)10-19(16)18-15/h2-9H,10H2,1H3.
What are the key properties of 2-(4-methylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole?
2-(4-methylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole has a molecular weight of 247.30 g/mol, XLogP of 3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole is sourced from PubChem (CID 1040002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).