C13H12N4S — CID 10400183
8-[(4-methylphenyl)methyl]-1H-imidazo[1,5-a][1,3,5]triazine-4-thione (PubChem CID 10400183) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is 8-[(4-methylphenyl)methyl]-1H-imidazo[1,5-a][1,3,5]triazine-4-thione.
| Compound Name | 8-[(4-methylphenyl)methyl]-1H-imidazo[1,5-a][1,3,5]triazine-4-thione |
|---|---|
| PubChem CID | 10400183 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 8-[(4-methylphenyl)methyl]-1H-imidazo[1,5-a][1,3,5]triazine-4-thione |
| SMILES | Cc1ccc(Cc2ncn3c(=S)nc[nH]c23)cc1 |
| InChI | InChI=1S/C13H12N4S/c1-9-2-4-10(5-3-9)6-11-12-14-7-15-13(18)17(12)8-16-11/h2-5,7-8H,6H2,1H3,(H,14,15,18) |
| InChIKey | VZAMVQWLVUCSDW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|