C16H20N2O — CID 10400189
8-(propylamino)-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde (PubChem CID 10400189) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 8-(propylamino)-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde.
| Compound Name | 8-(propylamino)-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde |
|---|---|
| PubChem CID | 10400189 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 8-(propylamino)-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde |
| SMILES | CCCNC1CCc2ccc3[nH]cc(C=O)c3c2C1 |
| InChI | InChI=1S/C16H20N2O/c1-2-7-17-13-5-3-11-4-6-15-16(14(11)8-13)12(10-19)9-18-15/h4,6,9-10,13,17-18H,2-3,5,7-8H2,1H3 |
| InChIKey | HUISJGMFDCMBAG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|