C15H28O3 — CID 10400192
2,2,6,6-tetraethyl-5-propan-2-yl-1,3-dioxan-4-one (PubChem CID 10400192) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2,2,6,6-tetraethyl-5-propan-2-yl-1,3-dioxan-4-one.
| Compound Name | 2,2,6,6-tetraethyl-5-propan-2-yl-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 10400192 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 2,2,6,6-tetraethyl-5-propan-2-yl-1,3-dioxan-4-one |
| SMILES | CCC1(CC)OC(=O)C(C(C)C)C(CC)(CC)O1 |
| InChI | InChI=1S/C15H28O3/c1-7-14(8-2)12(11(5)6)13(16)17-15(9-3,10-4)18-14/h11-12H,7-10H2,1-6H3 |
| InChIKey | RSRHYKIIXYDGEF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |