About (7Z,11Z)-4-methylheptadeca-7,11-dienal
(7Z,11Z)-4-methylheptadeca-7,11-dienal (PubChem CID 10400609) has the molecular formula C18H32O
and a molecular weight of 264.45 g/mol. Its IUPAC name is (7Z,11Z)-4-methylheptadeca-7,11-dienal.
Molecular Properties
| Compound Name | (7Z,11Z)-4-methylheptadeca-7,11-dienal |
| PubChem CID | 10400609 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | (7Z,11Z)-4-methylheptadeca-7,11-dienal |
| SMILES | CCCCC/C=C\CC/C=C\CCC(C)CCC=O |
| InChI | InChI=1S/C18H32O/c1-3-4-5-6-7-8-9-10-11-12-13-15-18(2)16-14-17-19/h7-8,11-12,17-18H,3-6,9-10,13-16H2,1-2H3/b8-7-,12-11- |
| InChIKey | BXUVLPDAJOPHFD-MQEUWQHPSA-N |
| XLogP | 5.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7Z,11Z)-4-methylheptadeca-7,11-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7Z,11Z)-4-methylheptadeca-7,11-dienal?
The IUPAC name of (7Z,11Z)-4-methylheptadeca-7,11-dienal (CID 10400609) is (7Z,11Z)-4-methylheptadeca-7,11-dienal.
What is the SMILES notation for (7Z,11Z)-4-methylheptadeca-7,11-dienal?
The canonical SMILES for (7Z,11Z)-4-methylheptadeca-7,11-dienal is CCCCC/C=C\CC/C=C\CCC(C)CCC=O.
What is the InChIKey of (7Z,11Z)-4-methylheptadeca-7,11-dienal?
The InChIKey is BXUVLPDAJOPHFD-MQEUWQHPSA-N. The full InChI is InChI=1S/C18H32O/c1-3-4-5-6-7-8-9-10-11-12-13-15-18(2)16-14-17-19/h7-8,11-12,17-18H,3-6,9-10,13-16H2,1-2H3/b8-7-,12-11-.
What are the key properties of (7Z,11Z)-4-methylheptadeca-7,11-dienal?
(7Z,11Z)-4-methylheptadeca-7,11-dienal has a molecular weight of 264.45 g/mol, XLogP of 5.85, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7Z,11Z)-4-methylheptadeca-7,11-dienal is sourced from PubChem (CID 10400609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).