C8H6F7NO — CID 10400615
2,2,3,3,4,4,4-heptafluoro-1-(1H-pyrrol-2-yl)butan-1-ol (PubChem CID 10400615) has the molecular formula C8H6F7NO and a molecular weight of 265.13 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-1-(1H-pyrrol-2-yl)butan-1-ol.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-1-(1H-pyrrol-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 10400615 |
| Molecular Formula | C8H6F7NO |
| Molecular Weight | 265.13 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-1-(1H-pyrrol-2-yl)butan-1-ol |
| SMILES | OC(c1ccc[nH]1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H6F7NO/c9-6(10,7(11,12)8(13,14)15)5(17)4-2-1-3-16-4/h1-3,5,16-17H |
| InChIKey | YYGDMWPVPDWMPY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.13 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|