C16H28O3 — CID 10400854
(2E,7E)-3,7-dimethyl-9-(oxan-2-yloxy)nona-2,7-dien-1-ol (PubChem CID 10400854) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is (2E,7E)-3,7-dimethyl-9-(oxan-2-yloxy)nona-2,7-dien-1-ol.
| Compound Name | (2E,7E)-3,7-dimethyl-9-(oxan-2-yloxy)nona-2,7-dien-1-ol |
|---|---|
| PubChem CID | 10400854 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (2E,7E)-3,7-dimethyl-9-(oxan-2-yloxy)nona-2,7-dien-1-ol |
| SMILES | C/C(=C\CO)CCC/C(C)=C/COC1CCCCO1 |
| InChI | InChI=1S/C16H28O3/c1-14(9-11-17)6-5-7-15(2)10-13-19-16-8-3-4-12-18-16/h9-10,16-17H,3-8,11-13H2,1-2H3/b14-9+,15-10+ |
| InChIKey | NBSIQOZECNKUIC-AOEKMSOUSA-N |
| XLogP | 3.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|