About 10-ethyl-3,8-dihydroxy-4-methylbenzo[c]chromen-6-one
10-ethyl-3,8-dihydroxy-4-methylbenzo[c]chromen-6-one (PubChem CID 10400919) has the molecular formula C16H14O4
and a molecular weight of 270.28 g/mol. Its IUPAC name is 10-ethyl-3,8-dihydroxy-4-methylbenzo[c]chromen-6-one.
Molecular Properties
| Compound Name | 10-ethyl-3,8-dihydroxy-4-methylbenzo[c]chromen-6-one |
| PubChem CID | 10400919 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 10-ethyl-3,8-dihydroxy-4-methylbenzo[c]chromen-6-one |
| SMILES | CCc1cc(O)cc2c(=O)oc3c(C)c(O)ccc3c12 |
| InChI | InChI=1S/C16H14O4/c1-3-9-6-10(17)7-12-14(9)11-4-5-13(18)8(2)15(11)20-16(12)19/h4-7,17-18H,3H2,1-2H3 |
| InChIKey | MCYAWLNSWNLXPT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 10-ethyl-3,8-dihydroxy-4-methylbenzo[c]chromen-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-ethyl-3,8-dihydroxy-4-methylbenzo[c]chromen-6-one?
The IUPAC name of 10-ethyl-3,8-dihydroxy-4-methylbenzo[c]chromen-6-one (CID 10400919) is 10-ethyl-3,8-dihydroxy-4-methylbenzo[c]chromen-6-one.
What is the SMILES notation for 10-ethyl-3,8-dihydroxy-4-methylbenzo[c]chromen-6-one?
The canonical SMILES for 10-ethyl-3,8-dihydroxy-4-methylbenzo[c]chromen-6-one is CCc1cc(O)cc2c(=O)oc3c(C)c(O)ccc3c12.
What is the InChIKey of 10-ethyl-3,8-dihydroxy-4-methylbenzo[c]chromen-6-one?
The InChIKey is MCYAWLNSWNLXPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O4/c1-3-9-6-10(17)7-12-14(9)11-4-5-13(18)8(2)15(11)20-16(12)19/h4-7,17-18H,3H2,1-2H3.
What are the key properties of 10-ethyl-3,8-dihydroxy-4-methylbenzo[c]chromen-6-one?
10-ethyl-3,8-dihydroxy-4-methylbenzo[c]chromen-6-one has a molecular weight of 270.28 g/mol, XLogP of 3.23, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-ethyl-3,8-dihydroxy-4-methylbenzo[c]chromen-6-one is sourced from PubChem (CID 10400919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).