C11H14N2O2S2 — CID 10400955
5-[(3aR,6aS)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]thiophene-2-sulfonamide (PubChem CID 10400955) has the molecular formula C11H14N2O2S2 and a molecular weight of 270.38 g/mol. Its IUPAC name is 5-[(3aR,6aS)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]thiophene-2-sulfonamide.
| Compound Name | 5-[(3aR,6aS)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 10400955 |
| Molecular Formula | C11H14N2O2S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 5-[(3aR,6aS)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C2=C[C@H]3CNC[C@H]3C2)s1 |
| InChI | InChI=1S/C11H14N2O2S2/c12-17(14,15)11-2-1-10(16-11)7-3-8-5-13-6-9(8)4-7/h1-3,8-9,13H,4-6H2,(H2,12,14,15)/t8-,9+/m0/s1 |
| InChIKey | TYTYGNYDODGHMD-DTWKUNHWSA-N |
| XLogP | 1.02 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |