C12H17BrO2 — CID 10401063
(3Z,4R,5S)-3-(bromomethylidene)-4-ethenyl-5-pentyloxolan-2-one (PubChem CID 10401063) has the molecular formula C12H17BrO2 and a molecular weight of 273.17 g/mol. Its IUPAC name is (3Z,4R,5S)-3-(bromomethylidene)-4-ethenyl-5-pentyloxolan-2-one.
| Compound Name | (3Z,4R,5S)-3-(bromomethylidene)-4-ethenyl-5-pentyloxolan-2-one |
|---|---|
| PubChem CID | 10401063 |
| Molecular Formula | C12H17BrO2 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | (3Z,4R,5S)-3-(bromomethylidene)-4-ethenyl-5-pentyloxolan-2-one |
| SMILES | C=C[C@@H]1/C(=C/Br)C(=O)O[C@H]1CCCCC |
| InChI | InChI=1S/C12H17BrO2/c1-3-5-6-7-11-9(4-2)10(8-13)12(14)15-11/h4,8-9,11H,2-3,5-7H2,1H3/b10-8-/t9-,11+/m1/s1 |
| InChIKey | NGFKHFKSXAAMIX-QTCFEDSUSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|