C12H20NO4P — CID 10401067
2-(diethoxyphosphorylmethyl)-4,5,6,7-tetrahydro-1,3-benzoxazole (PubChem CID 10401067) has the molecular formula C12H20NO4P and a molecular weight of 273.27 g/mol. Its IUPAC name is 2-(diethoxyphosphorylmethyl)-4,5,6,7-tetrahydro-1,3-benzoxazole.
| Compound Name | 2-(diethoxyphosphorylmethyl)-4,5,6,7-tetrahydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 10401067 |
| Molecular Formula | C12H20NO4P |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-(diethoxyphosphorylmethyl)-4,5,6,7-tetrahydro-1,3-benzoxazole |
| SMILES | CCOP(=O)(Cc1nc2c(o1)CCCC2)OCC |
| InChI | InChI=1S/C12H20NO4P/c1-3-15-18(14,16-4-2)9-12-13-10-7-5-6-8-11(10)17-12/h3-9H2,1-2H3 |
| InChIKey | JPPGNECFCRMMDZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|