About [4-(3,4-dichlorophenyl)-1-methylpiperidin-3-yl]methanol
[4-(3,4-dichlorophenyl)-1-methylpiperidin-3-yl]methanol (PubChem CID 10401105) has the molecular formula C13H17Cl2NO
and a molecular weight of 274.19 g/mol. Its IUPAC name is [4-(3,4-dichlorophenyl)-1-methylpiperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [4-(3,4-dichlorophenyl)-1-methylpiperidin-3-yl]methanol |
| PubChem CID | 10401105 |
| Molecular Formula | C13H17Cl2NO |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | [4-(3,4-dichlorophenyl)-1-methylpiperidin-3-yl]methanol |
| SMILES | CN1CCC(c2ccc(Cl)c(Cl)c2)C(CO)C1 |
| InChI | InChI=1S/C13H17Cl2NO/c1-16-5-4-11(10(7-16)8-17)9-2-3-12(14)13(15)6-9/h2-3,6,10-11,17H,4-5,7-8H2,1H3 |
| InChIKey | NMQQDLQLQBFQGS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-(3,4-dichlorophenyl)-1-methylpiperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,4-dichlorophenyl)-1-methylpiperidin-3-yl]methanol?
The IUPAC name of [4-(3,4-dichlorophenyl)-1-methylpiperidin-3-yl]methanol (CID 10401105) is [4-(3,4-dichlorophenyl)-1-methylpiperidin-3-yl]methanol.
What is the SMILES notation for [4-(3,4-dichlorophenyl)-1-methylpiperidin-3-yl]methanol?
The canonical SMILES for [4-(3,4-dichlorophenyl)-1-methylpiperidin-3-yl]methanol is CN1CCC(c2ccc(Cl)c(Cl)c2)C(CO)C1.
What is the InChIKey of [4-(3,4-dichlorophenyl)-1-methylpiperidin-3-yl]methanol?
The InChIKey is NMQQDLQLQBFQGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17Cl2NO/c1-16-5-4-11(10(7-16)8-17)9-2-3-12(14)13(15)6-9/h2-3,6,10-11,17H,4-5,7-8H2,1H3.
What are the key properties of [4-(3,4-dichlorophenyl)-1-methylpiperidin-3-yl]methanol?
[4-(3,4-dichlorophenyl)-1-methylpiperidin-3-yl]methanol has a molecular weight of 274.19 g/mol, XLogP of 3.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,4-dichlorophenyl)-1-methylpiperidin-3-yl]methanol is sourced from PubChem (CID 10401105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).