C20H34 — CID 10401147
(6E)-9-ethenyl-2,6,9,13-tetramethyltetradeca-2,6,12-triene (PubChem CID 10401147) has the molecular formula C20H34 and a molecular weight of 274.49 g/mol. Its IUPAC name is (6E)-9-ethenyl-2,6,9,13-tetramethyltetradeca-2,6,12-triene.
| Compound Name | (6E)-9-ethenyl-2,6,9,13-tetramethyltetradeca-2,6,12-triene |
|---|---|
| PubChem CID | 10401147 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | (6E)-9-ethenyl-2,6,9,13-tetramethyltetradeca-2,6,12-triene |
| SMILES | C=CC(C)(C/C=C(\C)CCC=C(C)C)CCC=C(C)C |
| InChI | InChI=1S/C20H34/c1-8-20(7,15-10-12-18(4)5)16-14-19(6)13-9-11-17(2)3/h8,11-12,14H,1,9-10,13,15-16H2,2-7H3/b19-14+ |
| InChIKey | MFGOTAHWOBKNNU-XMHGGMMESA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|