C16H28O4 — CID 10401631
ethyl 2-[(3S,4R,6S)-6-[(E)-but-1-enyl]-4,6-diethyldioxan-3-yl]acetate (PubChem CID 10401631) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is ethyl 2-[(3S,4R,6S)-6-[(E)-but-1-enyl]-4,6-diethyldioxan-3-yl]acetate.
| Compound Name | ethyl 2-[(3S,4R,6S)-6-[(E)-but-1-enyl]-4,6-diethyldioxan-3-yl]acetate |
|---|---|
| PubChem CID | 10401631 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | ethyl 2-[(3S,4R,6S)-6-[(E)-but-1-enyl]-4,6-diethyldioxan-3-yl]acetate |
| SMILES | CC/C=C/[C@]1(CC)C[C@@H](CC)[C@H](CC(=O)OCC)OO1 |
| InChI | InChI=1S/C16H28O4/c1-5-9-10-16(7-3)12-13(6-2)14(19-20-16)11-15(17)18-8-4/h9-10,13-14H,5-8,11-12H2,1-4H3/b10-9+/t13-,14+,16-/m1/s1 |
| InChIKey | HZBLNAHIQCGRAY-JCYOYESHSA-N |
| XLogP | 3.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|