C14H21ClN2O2 — CID 10401649
(2R,3E)-1-(tert-butylamino)-3-[(4-chlorophenyl)methoxyimino]propan-2-ol (PubChem CID 10401649) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is (2R,3E)-1-(tert-butylamino)-3-[(4-chlorophenyl)methoxyimino]propan-2-ol.
| Compound Name | (2R,3E)-1-(tert-butylamino)-3-[(4-chlorophenyl)methoxyimino]propan-2-ol |
|---|---|
| PubChem CID | 10401649 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (2R,3E)-1-(tert-butylamino)-3-[(4-chlorophenyl)methoxyimino]propan-2-ol |
| SMILES | CC(C)(C)NC[C@@H](O)/C=N/OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H21ClN2O2/c1-14(2,3)16-8-13(18)9-17-19-10-11-4-6-12(15)7-5-11/h4-7,9,13,16,18H,8,10H2,1-3H3/b17-9+/t13-/m1/s1 |
| InChIKey | OAPPBWDTBGYHGS-LFMVTYOGSA-N |
| XLogP | 2.59 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|