About 3-(2,2-dimethylpropoxy)-9H-pyrido[3,4-b]indole
3-(2,2-dimethylpropoxy)-9H-pyrido[3,4-b]indole (PubChem CID 10402001) has the molecular formula C16H18N2O
and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-(2,2-dimethylpropoxy)-9H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 3-(2,2-dimethylpropoxy)-9H-pyrido[3,4-b]indole |
| PubChem CID | 10402001 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 3-(2,2-dimethylpropoxy)-9H-pyrido[3,4-b]indole |
| SMILES | CC(C)(C)COc1cc2c(cn1)[nH]c1ccccc12 |
| InChI | InChI=1S/C16H18N2O/c1-16(2,3)10-19-15-8-12-11-6-4-5-7-13(11)18-14(12)9-17-15/h4-9,18H,10H2,1-3H3 |
| InChIKey | YABCOKXBPACNCE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,2-dimethylpropoxy)-9H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethylpropoxy)-9H-pyrido[3,4-b]indole?
The IUPAC name of 3-(2,2-dimethylpropoxy)-9H-pyrido[3,4-b]indole (CID 10402001) is 3-(2,2-dimethylpropoxy)-9H-pyrido[3,4-b]indole.
What is the SMILES notation for 3-(2,2-dimethylpropoxy)-9H-pyrido[3,4-b]indole?
The canonical SMILES for 3-(2,2-dimethylpropoxy)-9H-pyrido[3,4-b]indole is CC(C)(C)COc1cc2c(cn1)[nH]c1ccccc12.
What is the InChIKey of 3-(2,2-dimethylpropoxy)-9H-pyrido[3,4-b]indole?
The InChIKey is YABCOKXBPACNCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O/c1-16(2,3)10-19-15-8-12-11-6-4-5-7-13(11)18-14(12)9-17-15/h4-9,18H,10H2,1-3H3.
What are the key properties of 3-(2,2-dimethylpropoxy)-9H-pyrido[3,4-b]indole?
3-(2,2-dimethylpropoxy)-9H-pyrido[3,4-b]indole has a molecular weight of 254.33 g/mol, XLogP of 4.14, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethylpropoxy)-9H-pyrido[3,4-b]indole is sourced from PubChem (CID 10402001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).