C16H20O3S — CID 10402094
(4aR,6R,9aS)-2-phenylsulfanyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepine-6-carbaldehyde (PubChem CID 10402094) has the molecular formula C16H20O3S and a molecular weight of 292.40 g/mol. Its IUPAC name is (4aR,6R,9aS)-2-phenylsulfanyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepine-6-carbaldehyde.
| Compound Name | (4aR,6R,9aS)-2-phenylsulfanyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepine-6-carbaldehyde |
|---|---|
| PubChem CID | 10402094 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (4aR,6R,9aS)-2-phenylsulfanyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepine-6-carbaldehyde |
| SMILES | O=C[C@H]1CCC[C@@H]2OC(Sc3ccccc3)CC[C@H]2O1 |
| InChI | InChI=1S/C16H20O3S/c17-11-12-5-4-8-14-15(18-12)9-10-16(19-14)20-13-6-2-1-3-7-13/h1-3,6-7,11-12,14-16H,4-5,8-10H2/t12-,14+,15-,16?/m1/s1 |
| InChIKey | AYBDUOMXHKWKDN-PKPLTAIXSA-N |
| XLogP | 3.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|