C13H9ClN2O4 — CID 10402114
6-chloro-2-methylspiro[isoquinoline-4,3'-pyrrolidine]-1,2',3,5'-tetrone (PubChem CID 10402114) has the molecular formula C13H9ClN2O4 and a molecular weight of 292.68 g/mol. Its IUPAC name is 6-chloro-2-methylspiro[isoquinoline-4,3'-pyrrolidine]-1,2',3,5'-tetrone.
| Compound Name | 6-chloro-2-methylspiro[isoquinoline-4,3'-pyrrolidine]-1,2',3,5'-tetrone |
|---|---|
| PubChem CID | 10402114 |
| Molecular Formula | C13H9ClN2O4 |
| Molecular Weight | 292.68 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 6-chloro-2-methylspiro[isoquinoline-4,3'-pyrrolidine]-1,2',3,5'-tetrone |
| SMILES | CN1C(=O)c2ccc(Cl)cc2C2(CC(=O)NC2=O)C1=O |
| InChI | InChI=1S/C13H9ClN2O4/c1-16-10(18)7-3-2-6(14)4-8(7)13(12(16)20)5-9(17)15-11(13)19/h2-4H,5H2,1H3,(H,15,17,19) |
| InChIKey | NXVVCYVGZVGQBB-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.68 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|