About 4-chloro-5-pyridin-3-yl-5,6-dihydrobenzo[c][2,7]naphthyridine
4-chloro-5-pyridin-3-yl-5,6-dihydrobenzo[c][2,7]naphthyridine (PubChem CID 10402159) has the molecular formula C17H12ClN3
and a molecular weight of 293.76 g/mol. Its IUPAC name is 4-chloro-5-pyridin-3-yl-5,6-dihydrobenzo[c][2,7]naphthyridine.
Molecular Properties
| Compound Name | 4-chloro-5-pyridin-3-yl-5,6-dihydrobenzo[c][2,7]naphthyridine |
| PubChem CID | 10402159 |
| Molecular Formula | C17H12ClN3 |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 4-chloro-5-pyridin-3-yl-5,6-dihydrobenzo[c][2,7]naphthyridine |
| SMILES | Clc1nccc2c1C(c1cccnc1)Nc1ccccc1-2 |
| InChI | InChI=1S/C17H12ClN3/c18-17-15-13(7-9-20-17)12-5-1-2-6-14(12)21-16(15)11-4-3-8-19-10-11/h1-10,16,21H |
| InChIKey | ACIYXVHDYHHLQT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-5-pyridin-3-yl-5,6-dihydrobenzo[c][2,7]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-pyridin-3-yl-5,6-dihydrobenzo[c][2,7]naphthyridine?
The IUPAC name of 4-chloro-5-pyridin-3-yl-5,6-dihydrobenzo[c][2,7]naphthyridine (CID 10402159) is 4-chloro-5-pyridin-3-yl-5,6-dihydrobenzo[c][2,7]naphthyridine.
What is the SMILES notation for 4-chloro-5-pyridin-3-yl-5,6-dihydrobenzo[c][2,7]naphthyridine?
The canonical SMILES for 4-chloro-5-pyridin-3-yl-5,6-dihydrobenzo[c][2,7]naphthyridine is Clc1nccc2c1C(c1cccnc1)Nc1ccccc1-2.
What is the InChIKey of 4-chloro-5-pyridin-3-yl-5,6-dihydrobenzo[c][2,7]naphthyridine?
The InChIKey is ACIYXVHDYHHLQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12ClN3/c18-17-15-13(7-9-20-17)12-5-1-2-6-14(12)21-16(15)11-4-3-8-19-10-11/h1-10,16,21H.
What are the key properties of 4-chloro-5-pyridin-3-yl-5,6-dihydrobenzo[c][2,7]naphthyridine?
4-chloro-5-pyridin-3-yl-5,6-dihydrobenzo[c][2,7]naphthyridine has a molecular weight of 293.76 g/mol, XLogP of 4.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-pyridin-3-yl-5,6-dihydrobenzo[c][2,7]naphthyridine is sourced from PubChem (CID 10402159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).