C10H12N6OS2 — CID 10402326
N-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]acetamide (PubChem CID 10402326) has the molecular formula C10H12N6OS2 and a molecular weight of 296.38 g/mol. Its IUPAC name is N-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]acetamide.
| Compound Name | N-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 10402326 |
| Molecular Formula | C10H12N6OS2 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | N-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1nc(-c2csc(N=C(N)N)n2)cs1 |
| InChI | InChI=1S/C10H12N6OS2/c1-5(17)13-2-8-14-6(3-18-8)7-4-19-10(15-7)16-9(11)12/h3-4H,2H2,1H3,(H,13,17)(H4,11,12,15,16) |
| InChIKey | KVUUNXITELGRDD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|