C19H23NO2 — CID 10402378
6-methoxy-12-methyl-9-oxa-12-azatricyclo[13.4.0.03,8]nonadeca-1(19),3(8),4,6,15,17-hexaene (PubChem CID 10402378) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 6-methoxy-12-methyl-9-oxa-12-azatricyclo[13.4.0.03,8]nonadeca-1(19),3(8),4,6,15,17-hexaene.
| Compound Name | 6-methoxy-12-methyl-9-oxa-12-azatricyclo[13.4.0.03,8]nonadeca-1(19),3(8),4,6,15,17-hexaene |
|---|---|
| PubChem CID | 10402378 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 6-methoxy-12-methyl-9-oxa-12-azatricyclo[13.4.0.03,8]nonadeca-1(19),3(8),4,6,15,17-hexaene |
| SMILES | COc1ccc2c(c1)OCCN(C)CCc1ccccc1C2 |
| InChI | InChI=1S/C19H23NO2/c1-20-10-9-15-5-3-4-6-16(15)13-17-7-8-18(21-2)14-19(17)22-12-11-20/h3-8,14H,9-13H2,1-2H3 |
| InChIKey | QIMZPHYIPMOZHG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |