C21H18ClN3O2 — CID 1040246
(4R)-2-amino-4-(2-chloro-6,8-dimethylquinolin-3-yl)-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile (PubChem CID 1040246) has the molecular formula C21H18ClN3O2 and a molecular weight of 379.85 g/mol. Its IUPAC name is (4R)-2-amino-4-(2-chloro-6,8-dimethylquinolin-3-yl)-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile.
| Compound Name | (4R)-2-amino-4-(2-chloro-6,8-dimethylquinolin-3-yl)-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile |
|---|---|
| PubChem CID | 1040246 |
| Molecular Formula | C21H18ClN3O2 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | (4R)-2-amino-4-(2-chloro-6,8-dimethylquinolin-3-yl)-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile |
| SMILES | Cc1cc(C)c2nc(Cl)c([C@@H]3C(C#N)=C(N)OC4=C3C(=O)CCC4)cc2c1 |
| InChI | InChI=1S/C21H18ClN3O2/c1-10-6-11(2)19-12(7-10)8-13(20(22)25-19)17-14(9-23)21(24)27-16-5-3-4-15(26)18(16)17/h6-8,17H,3-5,24H2,1-2H3/t17-/m1/s1 |
| InChIKey | VLIPPJNTPABFIK-QGZVFWFLSA-N |
| XLogP | 4.32 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|