C15H24O6 — CID 10402531
[(Z,3S)-1-[(2S,3S,4R)-3-hydroxy-4-methoxy-6-oxooxan-2-yl]hept-1-en-3-yl] acetate (PubChem CID 10402531) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is [(Z,3S)-1-[(2S,3S,4R)-3-hydroxy-4-methoxy-6-oxooxan-2-yl]hept-1-en-3-yl] acetate.
| Compound Name | [(Z,3S)-1-[(2S,3S,4R)-3-hydroxy-4-methoxy-6-oxooxan-2-yl]hept-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 10402531 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | [(Z,3S)-1-[(2S,3S,4R)-3-hydroxy-4-methoxy-6-oxooxan-2-yl]hept-1-en-3-yl] acetate |
| SMILES | CCCC[C@@H](/C=C\[C@@H]1OC(=O)C[C@@H](OC)[C@@H]1O)OC(C)=O |
| InChI | InChI=1S/C15H24O6/c1-4-5-6-11(20-10(2)16)7-8-12-15(18)13(19-3)9-14(17)21-12/h7-8,11-13,15,18H,4-6,9H2,1-3H3/b8-7-/t11-,12-,13+,15+/m0/s1 |
| InChIKey | GKKOQWIEKASIGY-VMVKDKSBSA-N |
| XLogP | 1.36 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|