About 7-bromo-2-phenyl-1H-1,8-naphthyridin-4-one
7-bromo-2-phenyl-1H-1,8-naphthyridin-4-one (PubChem CID 10402581) has the molecular formula C14H9BrN2O
and a molecular weight of 301.14 g/mol. Its IUPAC name is 7-bromo-2-phenyl-1H-1,8-naphthyridin-4-one.
Molecular Properties
| Compound Name | 7-bromo-2-phenyl-1H-1,8-naphthyridin-4-one |
| PubChem CID | 10402581 |
| Molecular Formula | C14H9BrN2O |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 7-bromo-2-phenyl-1H-1,8-naphthyridin-4-one |
| SMILES | O=c1cc(-c2ccccc2)[nH]c2nc(Br)ccc12 |
| InChI | InChI=1S/C14H9BrN2O/c15-13-7-6-10-12(18)8-11(16-14(10)17-13)9-4-2-1-3-5-9/h1-8H,(H,16,17,18) |
| InChIKey | ZVIMMGQTBAKKGA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-2-phenyl-1H-1,8-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-phenyl-1H-1,8-naphthyridin-4-one?
The IUPAC name of 7-bromo-2-phenyl-1H-1,8-naphthyridin-4-one (CID 10402581) is 7-bromo-2-phenyl-1H-1,8-naphthyridin-4-one.
What is the SMILES notation for 7-bromo-2-phenyl-1H-1,8-naphthyridin-4-one?
The canonical SMILES for 7-bromo-2-phenyl-1H-1,8-naphthyridin-4-one is O=c1cc(-c2ccccc2)[nH]c2nc(Br)ccc12.
What is the InChIKey of 7-bromo-2-phenyl-1H-1,8-naphthyridin-4-one?
The InChIKey is ZVIMMGQTBAKKGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9BrN2O/c15-13-7-6-10-12(18)8-11(16-14(10)17-13)9-4-2-1-3-5-9/h1-8H,(H,16,17,18).
What are the key properties of 7-bromo-2-phenyl-1H-1,8-naphthyridin-4-one?
7-bromo-2-phenyl-1H-1,8-naphthyridin-4-one has a molecular weight of 301.14 g/mol, XLogP of 3.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-phenyl-1H-1,8-naphthyridin-4-one is sourced from PubChem (CID 10402581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).