About trans-(1R,2R)-1-methoxy-2-[(1S,2S)-2-methoxycyclohexyl]selanylcyclohexane
trans-(1R,2R)-1-methoxy-2-[(1S,2S)-2-methoxycyclohexyl]selanylcyclohexane (PubChem CID 10402818) has the molecular formula C14H26O2Se
and a molecular weight of 305.32 g/mol. Its IUPAC name is trans-(1R,2R)-1-methoxy-2-[(1S,2S)-2-methoxycyclohexyl]selanylcyclohexane.
Molecular Properties
| Compound Name | trans-(1R,2R)-1-methoxy-2-[(1S,2S)-2-methoxycyclohexyl]selanylcyclohexane |
| PubChem CID | 10402818 |
| Molecular Formula | C14H26O2Se |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | trans-(1R,2R)-1-methoxy-2-[(1S,2S)-2-methoxycyclohexyl]selanylcyclohexane |
| SMILES | CO[C@H]1CCCC[C@@H]1[Se][C@@H]1CCCC[C@H]1OC |
| InChI | InChI=1S/C14H26O2Se/c1-15-11-7-3-5-9-13(11)17-14-10-6-4-8-12(14)16-2/h11-14H,3-10H2,1-2H3/t11-,12+,13-,14+ |
| InChIKey | ULXAFVUNSBTUQJ-KPWCQOOUSA-N |
| XLogP | 3.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,2R)-1-methoxy-2-[(1S,2S)-2-methoxycyclohexyl]selanylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-1-methoxy-2-[(1S,2S)-2-methoxycyclohexyl]selanylcyclohexane?
The IUPAC name of trans-(1R,2R)-1-methoxy-2-[(1S,2S)-2-methoxycyclohexyl]selanylcyclohexane (CID 10402818) is trans-(1R,2R)-1-methoxy-2-[(1S,2S)-2-methoxycyclohexyl]selanylcyclohexane.
What is the SMILES notation for trans-(1R,2R)-1-methoxy-2-[(1S,2S)-2-methoxycyclohexyl]selanylcyclohexane?
The canonical SMILES for trans-(1R,2R)-1-methoxy-2-[(1S,2S)-2-methoxycyclohexyl]selanylcyclohexane is CO[C@H]1CCCC[C@@H]1[Se][C@@H]1CCCC[C@H]1OC.
What is the InChIKey of trans-(1R,2R)-1-methoxy-2-[(1S,2S)-2-methoxycyclohexyl]selanylcyclohexane?
The InChIKey is ULXAFVUNSBTUQJ-KPWCQOOUSA-N. The full InChI is InChI=1S/C14H26O2Se/c1-15-11-7-3-5-9-13(11)17-14-10-6-4-8-12(14)16-2/h11-14H,3-10H2,1-2H3/t11-,12+,13-,14+.
What are the key properties of trans-(1R,2R)-1-methoxy-2-[(1S,2S)-2-methoxycyclohexyl]selanylcyclohexane?
trans-(1R,2R)-1-methoxy-2-[(1S,2S)-2-methoxycyclohexyl]selanylcyclohexane has a molecular weight of 305.32 g/mol, XLogP of 3.45, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-1-methoxy-2-[(1S,2S)-2-methoxycyclohexyl]selanylcyclohexane is sourced from PubChem (CID 10402818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).