C11H8F8O — CID 10402988
5-(1,1,2,2,2-pentafluoroethyl)-5-[(E)-2-(2,2,2-trifluoroethoxy)ethenyl]cyclopenta-1,3-diene (PubChem CID 10402988) has the molecular formula C11H8F8O and a molecular weight of 308.17 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentafluoroethyl)-5-[(E)-2-(2,2,2-trifluoroethoxy)ethenyl]cyclopenta-1,3-diene.
| Compound Name | 5-(1,1,2,2,2-pentafluoroethyl)-5-[(E)-2-(2,2,2-trifluoroethoxy)ethenyl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 10402988 |
| Molecular Formula | C11H8F8O |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 5-(1,1,2,2,2-pentafluoroethyl)-5-[(E)-2-(2,2,2-trifluoroethoxy)ethenyl]cyclopenta-1,3-diene |
| SMILES | FC(F)(F)CO/C=C/C1(C(F)(F)C(F)(F)F)C=CC=C1 |
| InChI | InChI=1S/C11H8F8O/c12-9(13,14)7-20-6-5-8(3-1-2-4-8)10(15,16)11(17,18)19/h1-6H,7H2/b6-5+ |
| InChIKey | PYZVFNAZUMZACP-AATRIKPKSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|