C16H12N4OS — CID 10403012
3-(4-pyridin-4-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one (PubChem CID 10403012) has the molecular formula C16H12N4OS and a molecular weight of 308.37 g/mol. Its IUPAC name is 3-(4-pyridin-4-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one.
| Compound Name | 3-(4-pyridin-4-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 10403012 |
| Molecular Formula | C16H12N4OS |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 3-(4-pyridin-4-yl-1,3-thiazol-2-yl)-1,4-dihydroquinazolin-2-one |
| SMILES | O=C1Nc2ccccc2CN1c1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C16H12N4OS/c21-15-18-13-4-2-1-3-12(13)9-20(15)16-19-14(10-22-16)11-5-7-17-8-6-11/h1-8,10H,9H2,(H,18,21) |
| InChIKey | JEWCMAYLACWOQD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |