About 2-(4-ethylpiperazin-1-yl)pyrimido[2,1-a]isoquinolin-4-one
2-(4-ethylpiperazin-1-yl)pyrimido[2,1-a]isoquinolin-4-one (PubChem CID 10403020) has the molecular formula C18H20N4O
and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)pyrimido[2,1-a]isoquinolin-4-one.
Molecular Properties
| Compound Name | 2-(4-ethylpiperazin-1-yl)pyrimido[2,1-a]isoquinolin-4-one |
| PubChem CID | 10403020 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)pyrimido[2,1-a]isoquinolin-4-one |
| SMILES | CCN1CCN(c2cc(=O)n3ccc4ccccc4c3n2)CC1 |
| InChI | InChI=1S/C18H20N4O/c1-2-20-9-11-21(12-10-20)16-13-17(23)22-8-7-14-5-3-4-6-15(14)18(22)19-16/h3-8,13H,2,9-12H2,1H3 |
| InChIKey | CJNSAMKLCJKCHB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-ethylpiperazin-1-yl)pyrimido[2,1-a]isoquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethylpiperazin-1-yl)pyrimido[2,1-a]isoquinolin-4-one?
The IUPAC name of 2-(4-ethylpiperazin-1-yl)pyrimido[2,1-a]isoquinolin-4-one (CID 10403020) is 2-(4-ethylpiperazin-1-yl)pyrimido[2,1-a]isoquinolin-4-one.
What is the SMILES notation for 2-(4-ethylpiperazin-1-yl)pyrimido[2,1-a]isoquinolin-4-one?
The canonical SMILES for 2-(4-ethylpiperazin-1-yl)pyrimido[2,1-a]isoquinolin-4-one is CCN1CCN(c2cc(=O)n3ccc4ccccc4c3n2)CC1.
What is the InChIKey of 2-(4-ethylpiperazin-1-yl)pyrimido[2,1-a]isoquinolin-4-one?
The InChIKey is CJNSAMKLCJKCHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O/c1-2-20-9-11-21(12-10-20)16-13-17(23)22-8-7-14-5-3-4-6-15(14)18(22)19-16/h3-8,13H,2,9-12H2,1H3.
What are the key properties of 2-(4-ethylpiperazin-1-yl)pyrimido[2,1-a]isoquinolin-4-one?
2-(4-ethylpiperazin-1-yl)pyrimido[2,1-a]isoquinolin-4-one has a molecular weight of 308.38 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethylpiperazin-1-yl)pyrimido[2,1-a]isoquinolin-4-one is sourced from PubChem (CID 10403020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).