C14H18FN3O4 — CID 10403175
(2R)-2-[[2-amino-4-[(4-fluorophenyl)methylamino]-4-oxobutanoyl]amino]propanoic acid (PubChem CID 10403175) has the molecular formula C14H18FN3O4 and a molecular weight of 311.31 g/mol. Its IUPAC name is (2R)-2-[[2-amino-4-[(4-fluorophenyl)methylamino]-4-oxobutanoyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[2-amino-4-[(4-fluorophenyl)methylamino]-4-oxobutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10403175 |
| Molecular Formula | C14H18FN3O4 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (2R)-2-[[2-amino-4-[(4-fluorophenyl)methylamino]-4-oxobutanoyl]amino]propanoic acid |
| SMILES | C[C@@H](NC(=O)C(N)CC(=O)NCc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C14H18FN3O4/c1-8(14(21)22)18-13(20)11(16)6-12(19)17-7-9-2-4-10(15)5-3-9/h2-5,8,11H,6-7,16H2,1H3,(H,17,19)(H,18,20)(H,21,22)/t8-,11?/m1/s1 |
| InChIKey | BEMIMUZOEYYLQS-RZZZFEHKSA-N |
| XLogP | -0.25 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |