C18H17NO4 — CID 10403180
(3,5-dimethoxyphenyl)-(5-methoxy-1H-indol-2-yl)methanone (PubChem CID 10403180) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-(5-methoxy-1H-indol-2-yl)methanone.
| Compound Name | (3,5-dimethoxyphenyl)-(5-methoxy-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 10403180 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (3,5-dimethoxyphenyl)-(5-methoxy-1H-indol-2-yl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)c2cc3cc(OC)ccc3[nH]2)c1 |
| InChI | InChI=1S/C18H17NO4/c1-21-13-4-5-16-11(6-13)9-17(19-16)18(20)12-7-14(22-2)10-15(8-12)23-3/h4-10,19H,1-3H3 |
| InChIKey | XAQONWJORJYSDY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |