About 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]ethanol
2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]ethanol (PubChem CID 10403272) has the molecular formula C14H14Cl2N2O2
and a molecular weight of 313.18 g/mol. Its IUPAC name is 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]ethanol |
| PubChem CID | 10403272 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]ethanol |
| SMILES | OCCNc1ccc(OCc2c(Cl)cccc2Cl)cn1 |
| InChI | InChI=1S/C14H14Cl2N2O2/c15-12-2-1-3-13(16)11(12)9-20-10-4-5-14(18-8-10)17-6-7-19/h1-5,8,19H,6-7,9H2,(H,17,18) |
| InChIKey | OXFQJTPCLMTDEE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]ethanol?
The IUPAC name of 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]ethanol (CID 10403272) is 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]ethanol.
What is the SMILES notation for 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]ethanol?
The canonical SMILES for 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]ethanol is OCCNc1ccc(OCc2c(Cl)cccc2Cl)cn1.
What is the InChIKey of 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]ethanol?
The InChIKey is OXFQJTPCLMTDEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Cl2N2O2/c15-12-2-1-3-13(16)11(12)9-20-10-4-5-14(18-8-10)17-6-7-19/h1-5,8,19H,6-7,9H2,(H,17,18).
What are the key properties of 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]ethanol?
2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]ethanol has a molecular weight of 313.18 g/mol, XLogP of 3.37, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]ethanol is sourced from PubChem (CID 10403272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).