C11H17N5O4S — CID 10403419
ethyl 2-amino-4-(2-ethoxycarbonylhydrazinyl)-6-methylsulfanylpyrimidine-5-carboxylate (PubChem CID 10403419) has the molecular formula C11H17N5O4S and a molecular weight of 315.36 g/mol. Its IUPAC name is ethyl 2-amino-4-(2-ethoxycarbonylhydrazinyl)-6-methylsulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 2-amino-4-(2-ethoxycarbonylhydrazinyl)-6-methylsulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 10403419 |
| Molecular Formula | C11H17N5O4S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | ethyl 2-amino-4-(2-ethoxycarbonylhydrazinyl)-6-methylsulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)NNc1nc(N)nc(SC)c1C(=O)OCC |
| InChI | InChI=1S/C11H17N5O4S/c1-4-19-9(17)6-7(15-16-11(18)20-5-2)13-10(12)14-8(6)21-3/h4-5H2,1-3H3,(H,16,18)(H3,12,13,14,15) |
| InChIKey | PZJQNYIWCVLHQT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|