C21H23N3 — CID 10403546
7-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-2-phenylquinoxaline (PubChem CID 10403546) has the molecular formula C21H23N3 and a molecular weight of 317.44 g/mol. Its IUPAC name is 7-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-2-phenylquinoxaline.
| Compound Name | 7-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-2-phenylquinoxaline |
|---|---|
| PubChem CID | 10403546 |
| Molecular Formula | C21H23N3 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 7-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-2-phenylquinoxaline |
| SMILES | C[C@@H]1CCCN1CCc1ccc2ncc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C21H23N3/c1-16-6-5-12-24(16)13-11-17-9-10-19-20(14-17)23-21(15-22-19)18-7-3-2-4-8-18/h2-4,7-10,14-16H,5-6,11-13H2,1H3/t16-/m1/s1 |
| InChIKey | FTZQBDQZFRQAFW-MRXNPFEDSA-N |
| XLogP | 4.32 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |