About CID 10403599
CID 10403599 (PubChem CID 10403599) has the molecular formula C19H26O4
and a molecular weight of 318.41 g/mol.
Molecular Properties
| Compound Name | CID 10403599 |
| PubChem CID | 10403599 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | — |
| SMILES | O=C1CC2CC(C1)CC1(C2)OOC2(O1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C19H26O4/c20-17-7-13-2-14(8-17)10-18(9-13)21-19(23-22-18)15-3-11-1-12(5-15)6-16(19)4-11/h11-16H,1-10H2 |
| InChIKey | XJRBUNYATORMFQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 10403599 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10403599?
The IUPAC name of CID 10403599 (CID 10403599) is not available.
What is the SMILES notation for CID 10403599?
The canonical SMILES for CID 10403599 is O=C1CC2CC(C1)CC1(C2)OOC2(O1)C1CC3CC(C1)CC2C3.
What is the InChIKey of CID 10403599?
The InChIKey is XJRBUNYATORMFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O4/c20-17-7-13-2-14(8-17)10-18(9-13)21-19(23-22-18)15-3-11-1-12(5-15)6-16(19)4-11/h11-16H,1-10H2.
What are the key properties of CID 10403599?
CID 10403599 has a molecular weight of 318.41 g/mol, XLogP of 3.59, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10403599 is sourced from PubChem (CID 10403599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).