C11H10F3N3O3S — CID 10403773
4-[5-methoxy-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide (PubChem CID 10403773) has the molecular formula C11H10F3N3O3S and a molecular weight of 321.28 g/mol. Its IUPAC name is 4-[5-methoxy-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[5-methoxy-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10403773 |
| Molecular Formula | C11H10F3N3O3S |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 4-[5-methoxy-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| SMILES | COc1cc(C(F)(F)F)nn1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H10F3N3O3S/c1-20-10-6-9(11(12,13)14)16-17(10)7-2-4-8(5-3-7)21(15,18)19/h2-6H,1H3,(H2,15,18,19) |
| InChIKey | NICNWSHSMDLZMA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |