C18H19NO5 — CID 10404296
methyl 5-(7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-2-oxocyclohexane-1-carboxylate (PubChem CID 10404296) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is methyl 5-(7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-2-oxocyclohexane-1-carboxylate.
| Compound Name | methyl 5-(7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 10404296 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | methyl 5-(7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-2-oxocyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CC(C2=NCCc3cc4c(cc32)OCO4)CCC1=O |
| InChI | InChI=1S/C18H19NO5/c1-22-18(21)13-6-11(2-3-14(13)20)17-12-8-16-15(23-9-24-16)7-10(12)4-5-19-17/h7-8,11,13H,2-6,9H2,1H3 |
| InChIKey | HQDSJAAVRZYROM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|