C15H13Cl2N5 — CID 10404620
1-(3,4-dichlorophenyl)-2-phenyl-2H-1,3,5-triazine-4,6-diamine (PubChem CID 10404620) has the molecular formula C15H13Cl2N5 and a molecular weight of 334.21 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-phenyl-2H-1,3,5-triazine-4,6-diamine.
| Compound Name | 1-(3,4-dichlorophenyl)-2-phenyl-2H-1,3,5-triazine-4,6-diamine |
|---|---|
| PubChem CID | 10404620 |
| Molecular Formula | C15H13Cl2N5 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-phenyl-2H-1,3,5-triazine-4,6-diamine |
| SMILES | NC1=NC(c2ccccc2)N(c2ccc(Cl)c(Cl)c2)C(N)=N1 |
| InChI | InChI=1S/C15H13Cl2N5/c16-11-7-6-10(8-12(11)17)22-13(9-4-2-1-3-5-9)20-14(18)21-15(22)19/h1-8,13H,(H4,18,19,20,21) |
| InChIKey | POHPGOJAYHKLEL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |