C21H39NO2 — CID 10404829
(2S,5S,5aS,9aS)-8,8-dibutyl-2-(hydroxymethyl)-5,9a-dimethyl-1,2,3,5,5a,6,7,9-octahydrobenzo[d]azepin-4-one (PubChem CID 10404829) has the molecular formula C21H39NO2 and a molecular weight of 337.55 g/mol. Its IUPAC name is (2S,5S,5aS,9aS)-8,8-dibutyl-2-(hydroxymethyl)-5,9a-dimethyl-1,2,3,5,5a,6,7,9-octahydrobenzo[d]azepin-4-one.
| Compound Name | (2S,5S,5aS,9aS)-8,8-dibutyl-2-(hydroxymethyl)-5,9a-dimethyl-1,2,3,5,5a,6,7,9-octahydrobenzo[d]azepin-4-one |
|---|---|
| PubChem CID | 10404829 |
| Molecular Formula | C21H39NO2 |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.30 |
| IUPAC Name | (2S,5S,5aS,9aS)-8,8-dibutyl-2-(hydroxymethyl)-5,9a-dimethyl-1,2,3,5,5a,6,7,9-octahydrobenzo[d]azepin-4-one |
| SMILES | CCCCC1(CCCC)CC[C@H]2[C@H](C)C(=O)N[C@H](CO)C[C@]2(C)C1 |
| InChI | InChI=1S/C21H39NO2/c1-5-7-10-21(11-8-6-2)12-9-18-16(3)19(24)22-17(14-23)13-20(18,4)15-21/h16-18,23H,5-15H2,1-4H3,(H,22,24)/t16-,17-,18-,20+/m0/s1 |
| InChIKey | IZTPXJOJBPXANX-CGBFIWBNSA-N |
| XLogP | 4.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |