C13H11BrN2O4 — CID 10404899
methyl 2-(6-bromo-10,11-dioxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-yl)acetate (PubChem CID 10404899) has the molecular formula C13H11BrN2O4 and a molecular weight of 339.15 g/mol. Its IUPAC name is methyl 2-(6-bromo-10,11-dioxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-yl)acetate.
| Compound Name | methyl 2-(6-bromo-10,11-dioxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-yl)acetate |
|---|---|
| PubChem CID | 10404899 |
| Molecular Formula | C13H11BrN2O4 |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | methyl 2-(6-bromo-10,11-dioxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-yl)acetate |
| SMILES | COC(=O)CC1Cc2cc(Br)cc3[nH]c(=O)c(=O)n1c23 |
| InChI | InChI=1S/C13H11BrN2O4/c1-20-10(17)5-8-3-6-2-7(14)4-9-11(6)16(8)13(19)12(18)15-9/h2,4,8H,3,5H2,1H3,(H,15,18) |
| InChIKey | QPARKJZKCKHUMT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|