About 2-(4-chloro-2,6-dimethylphenoxy)-3,6-dimethyl-N-pentan-3-ylpyridin-4-amine
2-(4-chloro-2,6-dimethylphenoxy)-3,6-dimethyl-N-pentan-3-ylpyridin-4-amine (PubChem CID 10405373) has the molecular formula C20H27ClN2O
and a molecular weight of 346.90 g/mol. Its IUPAC name is 2-(4-chloro-2,6-dimethylphenoxy)-3,6-dimethyl-N-pentan-3-ylpyridin-4-amine.
Molecular Properties
| Compound Name | 2-(4-chloro-2,6-dimethylphenoxy)-3,6-dimethyl-N-pentan-3-ylpyridin-4-amine |
| PubChem CID | 10405373 |
| Molecular Formula | C20H27ClN2O |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 2-(4-chloro-2,6-dimethylphenoxy)-3,6-dimethyl-N-pentan-3-ylpyridin-4-amine |
| SMILES | CCC(CC)Nc1cc(C)nc(Oc2c(C)cc(Cl)cc2C)c1C |
| InChI | InChI=1S/C20H27ClN2O/c1-7-17(8-2)23-18-11-14(5)22-20(15(18)6)24-19-12(3)9-16(21)10-13(19)4/h9-11,17H,7-8H2,1-6H3,(H,22,23) |
| InChIKey | GATYVUUKXLTIJT-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-chloro-2,6-dimethylphenoxy)-3,6-dimethyl-N-pentan-3-ylpyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-2,6-dimethylphenoxy)-3,6-dimethyl-N-pentan-3-ylpyridin-4-amine?
The IUPAC name of 2-(4-chloro-2,6-dimethylphenoxy)-3,6-dimethyl-N-pentan-3-ylpyridin-4-amine (CID 10405373) is 2-(4-chloro-2,6-dimethylphenoxy)-3,6-dimethyl-N-pentan-3-ylpyridin-4-amine.
What is the SMILES notation for 2-(4-chloro-2,6-dimethylphenoxy)-3,6-dimethyl-N-pentan-3-ylpyridin-4-amine?
The canonical SMILES for 2-(4-chloro-2,6-dimethylphenoxy)-3,6-dimethyl-N-pentan-3-ylpyridin-4-amine is CCC(CC)Nc1cc(C)nc(Oc2c(C)cc(Cl)cc2C)c1C.
What is the InChIKey of 2-(4-chloro-2,6-dimethylphenoxy)-3,6-dimethyl-N-pentan-3-ylpyridin-4-amine?
The InChIKey is GATYVUUKXLTIJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27ClN2O/c1-7-17(8-2)23-18-11-14(5)22-20(15(18)6)24-19-12(3)9-16(21)10-13(19)4/h9-11,17H,7-8H2,1-6H3,(H,22,23).
What are the key properties of 2-(4-chloro-2,6-dimethylphenoxy)-3,6-dimethyl-N-pentan-3-ylpyridin-4-amine?
2-(4-chloro-2,6-dimethylphenoxy)-3,6-dimethyl-N-pentan-3-ylpyridin-4-amine has a molecular weight of 346.90 g/mol, XLogP of 6.36, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-2,6-dimethylphenoxy)-3,6-dimethyl-N-pentan-3-ylpyridin-4-amine is sourced from PubChem (CID 10405373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).