About 2-(4,5-dichloro-6-oxopyridazin-1-yl)ethyl-triethylazanium
2-(4,5-dichloro-6-oxopyridazin-1-yl)ethyl-triethylazanium (PubChem CID 1040543) has the molecular formula C12H20Cl2N3O+
and a molecular weight of 293.22 g/mol. Its IUPAC name is 2-(4,5-dichloro-6-oxopyridazin-1-yl)ethyl-triethylazanium.
Molecular Properties
| Compound Name | 2-(4,5-dichloro-6-oxopyridazin-1-yl)ethyl-triethylazanium |
| PubChem CID | 1040543 |
| Molecular Formula | C12H20Cl2N3O+ |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-(4,5-dichloro-6-oxopyridazin-1-yl)ethyl-triethylazanium |
| SMILES | CC[N+](CC)(CC)CCn1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C12H20Cl2N3O/c1-4-17(5-2,6-3)8-7-16-12(18)11(14)10(13)9-15-16/h9H,4-8H2,1-3H3/q+1 |
| InChIKey | BRQUUROFSOIBIL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-dichloro-6-oxopyridazin-1-yl)ethyl-triethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dichloro-6-oxopyridazin-1-yl)ethyl-triethylazanium?
The IUPAC name of 2-(4,5-dichloro-6-oxopyridazin-1-yl)ethyl-triethylazanium (CID 1040543) is 2-(4,5-dichloro-6-oxopyridazin-1-yl)ethyl-triethylazanium.
What is the SMILES notation for 2-(4,5-dichloro-6-oxopyridazin-1-yl)ethyl-triethylazanium?
The canonical SMILES for 2-(4,5-dichloro-6-oxopyridazin-1-yl)ethyl-triethylazanium is CC[N+](CC)(CC)CCn1ncc(Cl)c(Cl)c1=O.
What is the InChIKey of 2-(4,5-dichloro-6-oxopyridazin-1-yl)ethyl-triethylazanium?
The InChIKey is BRQUUROFSOIBIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20Cl2N3O/c1-4-17(5-2,6-3)8-7-16-12(18)11(14)10(13)9-15-16/h9H,4-8H2,1-3H3/q+1.
What are the key properties of 2-(4,5-dichloro-6-oxopyridazin-1-yl)ethyl-triethylazanium?
2-(4,5-dichloro-6-oxopyridazin-1-yl)ethyl-triethylazanium has a molecular weight of 293.22 g/mol, XLogP of 2.43, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dichloro-6-oxopyridazin-1-yl)ethyl-triethylazanium is sourced from PubChem (CID 1040543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).