C23H24Cl2O4 — CID 1040547
9-(3,5-dichloro-4-hydroxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 1040547) has the molecular formula C23H24Cl2O4 and a molecular weight of 435.35 g/mol. Its IUPAC name is 9-(3,5-dichloro-4-hydroxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-(3,5-dichloro-4-hydroxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 1040547 |
| Molecular Formula | C23H24Cl2O4 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 9-(3,5-dichloro-4-hydroxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC1=C(C(=O)CC(C)(C)C1)C2c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C23H24Cl2O4/c1-22(2)7-14(26)19-16(9-22)29-17-10-23(3,4)8-15(27)20(17)18(19)11-5-12(24)21(28)13(25)6-11/h5-6,18,28H,7-10H2,1-4H3 |
| InChIKey | FYJSFPDSGMFWAZ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |