About 5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]pyrrolidin-2-one
5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]pyrrolidin-2-one (PubChem CID 10405548) has the molecular formula C20H19N3OS
and a molecular weight of 349.46 g/mol. Its IUPAC name is 5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]pyrrolidin-2-one |
| PubChem CID | 10405548 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]pyrrolidin-2-one |
| SMILES | O=C1CCC(CSc2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)N1 |
| InChI | InChI=1S/C20H19N3OS/c24-17-12-11-16(21-17)13-25-20-22-18(14-7-3-1-4-8-14)19(23-20)15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,21,24)(H,22,23) |
| InChIKey | WSMIFTGUPARNSH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]pyrrolidin-2-one?
The IUPAC name of 5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]pyrrolidin-2-one (CID 10405548) is 5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]pyrrolidin-2-one.
What is the SMILES notation for 5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]pyrrolidin-2-one?
The canonical SMILES for 5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]pyrrolidin-2-one is O=C1CCC(CSc2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)N1.
What is the InChIKey of 5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]pyrrolidin-2-one?
The InChIKey is WSMIFTGUPARNSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3OS/c24-17-12-11-16(21-17)13-25-20-22-18(14-7-3-1-4-8-14)19(23-20)15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,21,24)(H,22,23).
What are the key properties of 5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]pyrrolidin-2-one?
5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]pyrrolidin-2-one has a molecular weight of 349.46 g/mol, XLogP of 4.11, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanylmethyl]pyrrolidin-2-one is sourced from PubChem (CID 10405548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).