C18H22O7 — CID 10405591
(3aS,5S,9bS)-5-methyl-7,8-di(propan-2-yloxy)-3,3a,5,9b-tetrahydrofuro[3,2-c]isochromene-2,6,9-trione (PubChem CID 10405591) has the molecular formula C18H22O7 and a molecular weight of 350.37 g/mol. Its IUPAC name is (3aS,5S,9bS)-5-methyl-7,8-di(propan-2-yloxy)-3,3a,5,9b-tetrahydrofuro[3,2-c]isochromene-2,6,9-trione.
| Compound Name | (3aS,5S,9bS)-5-methyl-7,8-di(propan-2-yloxy)-3,3a,5,9b-tetrahydrofuro[3,2-c]isochromene-2,6,9-trione |
|---|---|
| PubChem CID | 10405591 |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | (3aS,5S,9bS)-5-methyl-7,8-di(propan-2-yloxy)-3,3a,5,9b-tetrahydrofuro[3,2-c]isochromene-2,6,9-trione |
| SMILES | CC(C)OC1=C(OC(C)C)C(=O)C2=C(C1=O)[C@H](C)O[C@H]1CC(=O)O[C@@H]21 |
| InChI | InChI=1S/C18H22O7/c1-7(2)22-17-14(20)12-9(5)24-10-6-11(19)25-16(10)13(12)15(21)18(17)23-8(3)4/h7-10,16H,6H2,1-5H3/t9-,10-,16+/m0/s1 |
| InChIKey | JSJBLFWLPASWQQ-XQJJYNOISA-N |
| XLogP | 1.60 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|