C23H30N2O — CID 10405640
(1S,9S,13S)-10-[[4-(dimethylamino)phenyl]methyl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol (PubChem CID 10405640) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is (1S,9S,13S)-10-[[4-(dimethylamino)phenyl]methyl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol.
| Compound Name | (1S,9S,13S)-10-[[4-(dimethylamino)phenyl]methyl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 10405640 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | (1S,9S,13S)-10-[[4-(dimethylamino)phenyl]methyl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
| SMILES | C[C@@H]1[C@@H]2Cc3ccc(O)cc3[C@@]1(C)CCN2Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C23H30N2O/c1-16-22-13-18-7-10-20(26)14-21(18)23(16,2)11-12-25(22)15-17-5-8-19(9-6-17)24(3)4/h5-10,14,16,22,26H,11-13,15H2,1-4H3/t16-,22+,23+/m1/s1 |
| InChIKey | NXZXVKFNKILKQT-XARZLDAJSA-N |
| XLogP | 4.18 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|