C15H18BrN3O2 — CID 10405734
6-bromo-9-butan-2-yl-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione (PubChem CID 10405734) has the molecular formula C15H18BrN3O2 and a molecular weight of 352.23 g/mol. Its IUPAC name is 6-bromo-9-butan-2-yl-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione.
| Compound Name | 6-bromo-9-butan-2-yl-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 10405734 |
| Molecular Formula | C15H18BrN3O2 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 6-bromo-9-butan-2-yl-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione |
| SMILES | CCC(C)N1CCc2c(Br)cc3[nH]c(=O)c(=O)[nH]c3c2C1 |
| InChI | InChI=1S/C15H18BrN3O2/c1-3-8(2)19-5-4-9-10(7-19)13-12(6-11(9)16)17-14(20)15(21)18-13/h6,8H,3-5,7H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | JLUIVZIFGHVQKL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|