C14H19F7O2 — CID 10405737
1-cyclohexyl-3-ethoxy-4,4,5,5,6,6,6-heptafluorohexan-2-one (PubChem CID 10405737) has the molecular formula C14H19F7O2 and a molecular weight of 352.29 g/mol. Its IUPAC name is 1-cyclohexyl-3-ethoxy-4,4,5,5,6,6,6-heptafluorohexan-2-one.
| Compound Name | 1-cyclohexyl-3-ethoxy-4,4,5,5,6,6,6-heptafluorohexan-2-one |
|---|---|
| PubChem CID | 10405737 |
| Molecular Formula | C14H19F7O2 |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 1-cyclohexyl-3-ethoxy-4,4,5,5,6,6,6-heptafluorohexan-2-one |
| SMILES | CCOC(C(=O)CC1CCCCC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H19F7O2/c1-2-23-11(10(22)8-9-6-4-3-5-7-9)12(15,16)13(17,18)14(19,20)21/h9,11H,2-8H2,1H3 |
| InChIKey | PMLVQKXUINMCHU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|