C14H28O6P2 — CID 10405846
[(6E)-7,11-dimethyl-1-phosphonododeca-6,10-dienyl]phosphonic acid (PubChem CID 10405846) has the molecular formula C14H28O6P2 and a molecular weight of 354.32 g/mol. Its IUPAC name is [(6E)-7,11-dimethyl-1-phosphonododeca-6,10-dienyl]phosphonic acid.
| Compound Name | [(6E)-7,11-dimethyl-1-phosphonododeca-6,10-dienyl]phosphonic acid |
|---|---|
| PubChem CID | 10405846 |
| Molecular Formula | C14H28O6P2 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | [(6E)-7,11-dimethyl-1-phosphonododeca-6,10-dienyl]phosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CCCCC(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C14H28O6P2/c1-12(2)8-7-10-13(3)9-5-4-6-11-14(21(15,16)17)22(18,19)20/h8-9,14H,4-7,10-11H2,1-3H3,(H2,15,16,17)(H2,18,19,20)/b13-9+ |
| InChIKey | JCYZSGYSCXRCHX-UKTHLTGXSA-N |
| XLogP | 3.92 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|