About 3-piperazin-1-yl-1-[2-(2,4,5-trifluorophenoxy)ethyl]pyrazin-2-one
3-piperazin-1-yl-1-[2-(2,4,5-trifluorophenoxy)ethyl]pyrazin-2-one (PubChem CID 10405848) has the molecular formula C16H17F3N4O2
and a molecular weight of 354.33 g/mol. Its IUPAC name is 3-piperazin-1-yl-1-[2-(2,4,5-trifluorophenoxy)ethyl]pyrazin-2-one.
Molecular Properties
| Compound Name | 3-piperazin-1-yl-1-[2-(2,4,5-trifluorophenoxy)ethyl]pyrazin-2-one |
| PubChem CID | 10405848 |
| Molecular Formula | C16H17F3N4O2 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 3-piperazin-1-yl-1-[2-(2,4,5-trifluorophenoxy)ethyl]pyrazin-2-one |
| SMILES | O=c1c(N2CCNCC2)nccn1CCOc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C16H17F3N4O2/c17-11-9-13(19)14(10-12(11)18)25-8-7-23-6-3-21-15(16(23)24)22-4-1-20-2-5-22/h3,6,9-10,20H,1-2,4-5,7-8H2 |
| InChIKey | WGHXRGUSQHHKHR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-piperazin-1-yl-1-[2-(2,4,5-trifluorophenoxy)ethyl]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperazin-1-yl-1-[2-(2,4,5-trifluorophenoxy)ethyl]pyrazin-2-one?
The IUPAC name of 3-piperazin-1-yl-1-[2-(2,4,5-trifluorophenoxy)ethyl]pyrazin-2-one (CID 10405848) is 3-piperazin-1-yl-1-[2-(2,4,5-trifluorophenoxy)ethyl]pyrazin-2-one.
What is the SMILES notation for 3-piperazin-1-yl-1-[2-(2,4,5-trifluorophenoxy)ethyl]pyrazin-2-one?
The canonical SMILES for 3-piperazin-1-yl-1-[2-(2,4,5-trifluorophenoxy)ethyl]pyrazin-2-one is O=c1c(N2CCNCC2)nccn1CCOc1cc(F)c(F)cc1F.
What is the InChIKey of 3-piperazin-1-yl-1-[2-(2,4,5-trifluorophenoxy)ethyl]pyrazin-2-one?
The InChIKey is WGHXRGUSQHHKHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F3N4O2/c17-11-9-13(19)14(10-12(11)18)25-8-7-23-6-3-21-15(16(23)24)22-4-1-20-2-5-22/h3,6,9-10,20H,1-2,4-5,7-8H2.
What are the key properties of 3-piperazin-1-yl-1-[2-(2,4,5-trifluorophenoxy)ethyl]pyrazin-2-one?
3-piperazin-1-yl-1-[2-(2,4,5-trifluorophenoxy)ethyl]pyrazin-2-one has a molecular weight of 354.33 g/mol, XLogP of 1.15, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperazin-1-yl-1-[2-(2,4,5-trifluorophenoxy)ethyl]pyrazin-2-one is sourced from PubChem (CID 10405848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).